C27H23N3O2 — CID 118796982
17-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 118796982) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 17-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 118796982 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 17-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CN(C)c1ccc(/C=N\N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C27H23N3O2/c1-29(2)17-13-11-16(12-14-17)15-28-30-26(31)24-22-18-7-3-4-8-19(18)23(25(24)27(30)32)21-10-6-5-9-20(21)22/h3-15,22-25H,1-2H3/b28-15- |
| InChIKey | BIMUHXBKVWHZMO-MBTHVWNTSA-N |
| XLogP | 3.98 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|