C22H19N5O5S — CID 137070403
1-(4-ethoxyphenyl)-6-hydroxy-5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 137070403) has the molecular formula C22H19N5O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-6-hydroxy-5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070403 |
| Molecular Formula | C22H19N5O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | CCOc1ccc(-n2c(O)c(C=Nc3nnc(-c4ccc(OC)cc4)s3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H19N5O5S/c1-3-32-16-10-6-14(7-11-16)27-20(29)17(18(28)24-22(27)30)12-23-21-26-25-19(33-21)13-4-8-15(31-2)9-5-13/h4-12,29H,3H2,1-2H3,(H,24,28,30) |
| InChIKey | JMKTYIROMPFASO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|