C20H20N4O6S — CID 137070426
N-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 137070426) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 137070426 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(-n2c(O)c(C=NNS(=O)(=O)c3ccc(C)cc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c1-3-30-15-8-6-14(7-9-15)24-19(26)17(18(25)22-20(24)27)12-21-23-31(28,29)16-10-4-13(2)5-11-16/h4-12,23,26H,3H2,1-2H3,(H,22,25,27) |
| InChIKey | OWTOJHULWQIKGV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|