C22H23N3O3S — CID 5104980
1-(4-ethoxyphenyl)-5-[(2-ethyl-6-methylphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 5104980) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-[(2-ethyl-6-methylphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-ethoxyphenyl)-5-[(2-ethyl-6-methylphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 5104980 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-[(2-ethyl-6-methylphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/c3c(C)cccc3CC)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-4-15-8-6-7-14(3)19(15)23-13-18-20(26)24-22(29)25(21(18)27)16-9-11-17(12-10-16)28-5-2/h6-13,27H,4-5H2,1-3H3,(H,24,26,29)/b23-13+ |
| InChIKey | CRPWBJBBKHEHMP-YDZHTSKRSA-N |
| XLogP | 4.62 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|