C17H20N4O4S — CID 135485078
1-(4-ethoxyphenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 135485078) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135485078 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-6-hydroxy-5-[(E)-morpholin-4-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/N3CCOCC3)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H20N4O4S/c1-2-25-13-5-3-12(4-6-13)21-16(23)14(15(22)19-17(21)26)11-18-20-7-9-24-10-8-20/h3-6,11,23H,2,7-10H2,1H3,(H,19,22,26)/b18-11+ |
| InChIKey | VGFOHFZBQWMYET-WOJGMQOQSA-N |
| XLogP | 1.67 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|