C13H15N3O3S — CID 135614386
4-ethoxy-N-[(E)-1H-pyrrol-2-ylmethylideneamino]benzenesulfonamide (PubChem CID 135614386) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-ethoxy-N-[(E)-1H-pyrrol-2-ylmethylideneamino]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[(E)-1H-pyrrol-2-ylmethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135614386 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-ethoxy-N-[(E)-1H-pyrrol-2-ylmethylideneamino]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C/c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C13H15N3O3S/c1-2-19-12-5-7-13(8-6-12)20(17,18)16-15-10-11-4-3-9-14-11/h3-10,14,16H,2H2,1H3/b15-10+ |
| InChIKey | GVCPIGLTUNZZQU-XNTDXEJSSA-N |
| XLogP | 1.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|