C21H18N4O4S — CID 4606966
1-(3,4-dimethylphenyl)-6-hydroxy-5-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 4606966) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4606966 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc2nc(N=Cc3c(O)n(-c4ccc(C)c(C)c4)c(=O)[nH]c3=O)sc2c1 |
| InChI | InChI=1S/C21H18N4O4S/c1-11-4-5-13(8-12(11)2)25-19(27)15(18(26)24-21(25)28)10-22-20-23-16-7-6-14(29-3)9-17(16)30-20/h4-10,27H,1-3H3,(H,24,26,28) |
| InChIKey | DACVWCGGTQBGSN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|