C22H22N4O4 — CID 1397890
N-[2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide (PubChem CID 1397890) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide.
| Compound Name | N-[2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide |
|---|---|
| PubChem CID | 1397890 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccccc1/N=C/c1c(O)n(-c2ccc(C)c(C)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H22N4O4/c1-4-19(27)24-18-8-6-5-7-17(18)23-12-16-20(28)25-22(30)26(21(16)29)15-10-9-13(2)14(3)11-15/h5-12,29H,4H2,1-3H3,(H,24,27)(H,25,28,30)/b23-12+ |
| InChIKey | QUFJYVVUWUZHRU-FSJBWODESA-N |
| XLogP | 2.95 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|