C29H24N4O5S — CID 2394649
(5Z)-3-[2-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]ethyl]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 2394649) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is (5Z)-3-[2-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]ethyl]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]ethyl]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2394649 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | (5Z)-3-[2-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]ethyl]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/CCN3C(=O)S/C(=C\c4cccnc4)C3=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H24N4O5S/c1-2-38-21-11-9-20(10-12-21)33-26(34)23-8-4-3-7-22(23)24(27(33)35)18-31-14-15-32-28(36)25(39-29(32)37)16-19-6-5-13-30-17-19/h3-13,16-18,35H,2,14-15H2,1H3/b25-16-,31-18+ |
| InChIKey | XFIWPKNRZVNRJG-HCSITHJTSA-N |
| XLogP | 4.65 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|