C21H20ClN3O4S — CID 2457532
2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methylpropanamide (PubChem CID 2457532) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 2457532 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[(5E)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCCN1C(=O)S/C(=C/c2cccnc2)C1=O |
| InChI | InChI=1S/C21H20ClN3O4S/c1-21(2,29-16-7-5-15(22)6-8-16)19(27)24-10-11-25-18(26)17(30-20(25)28)12-14-4-3-9-23-13-14/h3-9,12-13H,10-11H2,1-2H3,(H,24,27)/b17-12+ |
| InChIKey | CGMPHEWFDHORKJ-SFQUDFHCSA-N |
| XLogP | 3.75 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|