C27H20ClN5O3S — CID 3951573
3-(4-chlorophenyl)-N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 3951573) has the molecular formula C27H20ClN5O3S and a molecular weight of 530.01 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 3951573 |
| Molecular Formula | C27H20ClN5O3S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-[2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2cccnc2)C1=O)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN5O3S/c28-20-10-8-19(9-11-20)24-22(17-33(31-24)21-6-2-1-3-7-21)25(34)30-13-14-32-26(35)23(37-27(32)36)15-18-5-4-12-29-16-18/h1-12,15-17H,13-14H2,(H,30,34) |
| InChIKey | MKROVVRNNQNQRJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|