C23H17N3O3S — CID 135674658
2-[(E)-[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile (PubChem CID 135674658) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[(E)-[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile.
| Compound Name | 2-[(E)-[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 135674658 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[(E)-[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/c3sccc3C#N)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H17N3O3S/c1-2-29-17-9-7-16(8-10-17)26-22(27)19-6-4-3-5-18(19)20(23(26)28)14-25-21-15(13-24)11-12-30-21/h3-12,14,28H,2H2,1H3/b25-14+ |
| InChIKey | AQAZUEIASFJRAF-AFUMVMLFSA-N |
| XLogP | 4.78 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|