C21H12ClN3O2S — CID 137132847
2-[[2-(2-chlorophenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile (PubChem CID 137132847) has the molecular formula C21H12ClN3O2S and a molecular weight of 405.87 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile.
| Compound Name | 2-[[2-(2-chlorophenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137132847 |
| Molecular Formula | C21H12ClN3O2S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]thiophene-3-carbonitrile |
| SMILES | N#Cc1ccsc1N=Cc1c(O)n(-c2ccccc2Cl)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H12ClN3O2S/c22-17-7-3-4-8-18(17)25-20(26)15-6-2-1-5-14(15)16(21(25)27)12-24-19-13(11-23)9-10-28-19/h1-10,12,27H |
| InChIKey | PAUUEVLGFGUFCD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|