C20H12Cl2N4O2 — CID 135674685
4-[(3,5-dichloro-4-pyridinyl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one (PubChem CID 135674685) has the molecular formula C20H12Cl2N4O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 135674685 |
| Molecular Formula | C20H12Cl2N4O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2c(Cl)cncc2Cl)c(O)n1-c1ccccn1 |
| InChI | InChI=1S/C20H12Cl2N4O2/c21-15-10-23-11-16(22)18(15)25-9-14-12-5-1-2-6-13(12)19(27)26(20(14)28)17-7-3-4-8-24-17/h1-11,28H/b25-9+ |
| InChIKey | CBWZIRPIOREAIX-YCPBAFNGSA-N |
| XLogP | 4.54 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|