C22H16N4O4 — CID 135709405
3-hydroxy-N-[(E)-(3-hydroxy-1-oxo-2-pyridin-2-ylisoquinolin-4-yl)methylideneamino]benzamide (PubChem CID 135709405) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is 3-hydroxy-N-[(E)-(3-hydroxy-1-oxo-2-pyridin-2-ylisoquinolin-4-yl)methylideneamino]benzamide.
| Compound Name | 3-hydroxy-N-[(E)-(3-hydroxy-1-oxo-2-pyridin-2-ylisoquinolin-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135709405 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-hydroxy-N-[(E)-(3-hydroxy-1-oxo-2-pyridin-2-ylisoquinolin-4-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2ccccn2)c(=O)c2ccccc12)c1cccc(O)c1 |
| InChI | InChI=1S/C22H16N4O4/c27-15-7-5-6-14(12-15)20(28)25-24-13-18-16-8-1-2-9-17(16)21(29)26(22(18)30)19-10-3-4-11-23-19/h1-13,27,30H,(H,25,28)/b24-13+ |
| InChIKey | ZKNJSWNIXCPHGF-ZMOGYAJESA-N |
| XLogP | 2.56 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|