C17H13N3O4 — CID 137098407
3-hydroxy-N-[(3-hydroxy-1-oxo-2H-isoquinolin-4-yl)methylideneamino]benzamide (PubChem CID 137098407) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 3-hydroxy-N-[(3-hydroxy-1-oxo-2H-isoquinolin-4-yl)methylideneamino]benzamide.
| Compound Name | 3-hydroxy-N-[(3-hydroxy-1-oxo-2H-isoquinolin-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137098407 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-hydroxy-N-[(3-hydroxy-1-oxo-2H-isoquinolin-4-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1c(O)[nH]c(=O)c2ccccc12)c1cccc(O)c1 |
| InChI | InChI=1S/C17H13N3O4/c21-11-5-3-4-10(8-11)15(22)20-18-9-14-12-6-1-2-7-13(12)16(23)19-17(14)24/h1-9,21H,(H,20,22)(H2,19,23,24) |
| InChIKey | AASVPIPKYKJVMS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|