C27H21ClF3N3O5S — CID 3279547
4-[(4-chloro-3-morpholin-4-ylsulfonylphenyl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 3279547) has the molecular formula C27H21ClF3N3O5S and a molecular weight of 592.00 g/mol. Its IUPAC name is 4-[(4-chloro-3-morpholin-4-ylsulfonylphenyl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 4-[(4-chloro-3-morpholin-4-ylsulfonylphenyl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 3279547 |
| Molecular Formula | C27H21ClF3N3O5S |
| Molecular Weight | 592.00 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | 4-[(4-chloro-3-morpholin-4-ylsulfonylphenyl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)c(O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21ClF3N3O5S/c28-23-9-8-18(15-24(23)40(37,38)33-10-12-39-13-11-33)32-16-22-20-6-1-2-7-21(20)25(35)34(26(22)36)19-5-3-4-17(14-19)27(29,30)31/h1-9,14-16,36H,10-13H2/b32-16+ |
| InChIKey | MUWVASNERNCMKA-KPGMTVGESA-N |
| XLogP | 5.14 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|