C23H16F3N3O2 — CID 2398465
3-hydroxy-2-(6-methyl-2-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one (PubChem CID 2398465) has the molecular formula C23H16F3N3O2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 3-hydroxy-2-(6-methyl-2-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-2-(6-methyl-2-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2398465 |
| Molecular Formula | C23H16F3N3O2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-hydroxy-2-(6-methyl-2-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one |
| SMILES | Cc1cccc(-n2c(O)c(/C=N/c3cccc(C(F)(F)F)c3)c3ccccc3c2=O)n1 |
| InChI | InChI=1S/C23H16F3N3O2/c1-14-6-4-11-20(28-14)29-21(30)18-10-3-2-9-17(18)19(22(29)31)13-27-16-8-5-7-15(12-16)23(24,25)26/h2-13,31H,1H3/b27-13+ |
| InChIKey | AXMPQUBPQYDUQX-UVHMKAGCSA-N |
| XLogP | 5.17 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|