C25H17F3N2O4 — CID 2339247
2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one (PubChem CID 2339247) has the molecular formula C25H17F3N2O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2339247 |
| Molecular Formula | C25H17F3N2O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]iminomethyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2cccc(C(F)(F)F)c2)c(O)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H17F3N2O4/c26-25(27,28)16-4-3-5-17(11-16)29-12-20-18-6-1-2-7-19(18)23(31)30(24(20)32)13-15-8-9-21-22(10-15)34-14-33-21/h1-12,32H,13-14H2/b29-12+ |
| InChIKey | POZRSMGDUKLKER-XKJRVUDJSA-N |
| XLogP | 5.25 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|