C23H18N4O4S2 — CID 135481407
2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[(E)-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]isoquinolin-1-one (PubChem CID 135481407) has the molecular formula C23H18N4O4S2 and a molecular weight of 478.56 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[(E)-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]isoquinolin-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[(E)-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135481407 |
| Molecular Formula | C23H18N4O4S2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-4-[(E)-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]isoquinolin-1-one |
| SMILES | C=CCSc1nnc(/N=C/c2c(O)n(Cc3ccc4c(c3)OCO4)c(=O)c3ccccc23)s1 |
| InChI | InChI=1S/C23H18N4O4S2/c1-2-9-32-23-26-25-22(33-23)24-11-17-15-5-3-4-6-16(15)20(28)27(21(17)29)12-14-7-8-18-19(10-14)31-13-30-18/h2-8,10-11,29H,1,9,12-13H2/b24-11+ |
| InChIKey | CGGGTNIYALBRIE-BHGWPJFGSA-N |
| XLogP | 4.36 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|