C29H26N2O6 — CID 3879666
butyl 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzoate (PubChem CID 3879666) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is butyl 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzoate.
| Compound Name | butyl 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 3879666 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | butyl 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(/N=C/c2c(O)n(Cc3ccc4c(c3)OCO4)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C29H26N2O6/c1-2-3-14-35-29(34)20-9-11-21(12-10-20)30-16-24-22-6-4-5-7-23(22)27(32)31(28(24)33)17-19-8-13-25-26(15-19)37-18-36-25/h4-13,15-16,33H,2-3,14,17-18H2,1H3/b30-16+ |
| InChIKey | XDASOLGCYHGYNJ-OKCVXOCRSA-N |
| XLogP | 5.19 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|