C25H16N4O6 — CID 5006183
2-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-5-nitrobenzonitrile (PubChem CID 5006183) has the molecular formula C25H16N4O6 and a molecular weight of 468.43 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-5-nitrobenzonitrile.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 5006183 |
| Molecular Formula | C25H16N4O6 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1/N=C/c1c(O)n(Cc2ccc3c(c2)OCO3)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H16N4O6/c26-11-16-10-17(29(32)33)6-7-21(16)27-12-20-18-3-1-2-4-19(18)24(30)28(25(20)31)13-15-5-8-22-23(9-15)35-14-34-22/h1-10,12,31H,13-14H2/b27-12+ |
| InChIKey | HXMCYQHCCPMPTN-KKMKTNMSSA-N |
| XLogP | 4.01 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|