C27H23N3O5S — CID 136575523
N-[(E)-[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 136575523) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[(E)-[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(E)-[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 136575523 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-[(E)-[2-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)n(Cc2ccc3c(c2)OCO3)c(=O)c2ccccc12)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C27H23N3O5S/c31-25(24-12-17-5-1-4-8-23(17)36-24)29-28-13-20-18-6-2-3-7-19(18)26(32)30(27(20)33)14-16-9-10-21-22(11-16)35-15-34-21/h2-3,6-7,9-13,33H,1,4-5,8,14-15H2,(H,29,31)/b28-13+ |
| InChIKey | CFWIUJVYNHGASI-XODNFHPESA-N |
| XLogP | 4.19 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|