C32H30F3N5O5 — CID 5199124
3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]propanamide (PubChem CID 5199124) has the molecular formula C32H30F3N5O5 and a molecular weight of 621.62 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]propanamide.
| Compound Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 5199124 |
| Molecular Formula | C32H30F3N5O5 |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]propanamide |
| SMILES | O=C(CCN1CCN(Cc2ccc3c(c2)OCO3)CC1)NN=Cc1c(O)n(-c2ccccc2C(F)(F)F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C32H30F3N5O5/c33-32(34,35)25-7-3-4-8-26(25)40-30(42)23-6-2-1-5-22(23)24(31(40)43)18-36-37-29(41)11-12-38-13-15-39(16-14-38)19-21-9-10-27-28(17-21)45-20-44-27/h1-10,17-18,43H,11-16,19-20H2,(H,37,41) |
| InChIKey | WGBYPLJJRDOACT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|