C22H17N3O3S — CID 135609338
N-[(E)-(2-benzyl-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 135609338) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[(E)-(2-benzyl-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(2-benzyl-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135609338 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(E)-(2-benzyl-3-hydroxy-1-oxoisoquinolin-4-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)n(Cc2ccccc2)c(=O)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C22H17N3O3S/c26-20(19-11-6-12-29-19)24-23-13-18-16-9-4-5-10-17(16)21(27)25(22(18)28)14-15-7-2-1-3-8-15/h1-13,28H,14H2,(H,24,26)/b23-13+ |
| InChIKey | VVUGIQFAUHODOP-YDZHTSKRSA-N |
| XLogP | 3.58 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|