C23H16N2O3S — CID 4093667
[1-[(thiophene-2-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate (PubChem CID 4093667) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is [1-[(thiophene-2-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(thiophene-2-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 4093667 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [1-[(thiophene-2-carbonylhydrazinylidene)methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1C=NNC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C23H16N2O3S/c26-22(21-11-6-14-29-21)25-24-15-19-18-10-5-4-7-16(18)12-13-20(19)28-23(27)17-8-2-1-3-9-17/h1-15H,(H,25,26) |
| InChIKey | FQJVDJXBQFAVDH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|