C22H18FN3OS — CID 1257534
N-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]thiophene-2-carboxamide (PubChem CID 1257534) has the molecular formula C22H18FN3OS and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1257534 |
| Molecular Formula | C22H18FN3OS |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]thiophene-2-carboxamide |
| SMILES | Cc1c(C=NNC(=O)c2cccs2)c2ccccc2n1Cc1ccccc1F |
| InChI | InChI=1S/C22H18FN3OS/c1-15-18(13-24-25-22(27)21-11-6-12-28-21)17-8-3-5-10-20(17)26(15)14-16-7-2-4-9-19(16)23/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | NKXPHXPASGXGQQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|