C20H22N2O5 — CID 3806623
butyl 4-(1,3-benzodioxol-5-ylmethylcarbamoylamino)benzoate (PubChem CID 3806623) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is butyl 4-(1,3-benzodioxol-5-ylmethylcarbamoylamino)benzoate.
| Compound Name | butyl 4-(1,3-benzodioxol-5-ylmethylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 3806623 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | butyl 4-(1,3-benzodioxol-5-ylmethylcarbamoylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-2-3-10-25-19(23)15-5-7-16(8-6-15)22-20(24)21-12-14-4-9-17-18(11-14)27-13-26-17/h4-9,11H,2-3,10,12-13H2,1H3,(H2,21,22,24) |
| InChIKey | XVYAQJVJLBJYEH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|