C23H24N2O6 — CID 2937089
butyl 4-[3-(1,3-benzodioxol-5-ylmethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 2937089) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is butyl 4-[3-(1,3-benzodioxol-5-ylmethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | butyl 4-[3-(1,3-benzodioxol-5-ylmethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 2937089 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | butyl 4-[3-(1,3-benzodioxol-5-ylmethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)CC(NCc3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O6/c1-2-3-10-29-23(28)16-5-7-17(8-6-16)25-21(26)12-18(22(25)27)24-13-15-4-9-19-20(11-15)31-14-30-19/h4-9,11,18,24H,2-3,10,12-14H2,1H3 |
| InChIKey | FYKGBTQSEYXJRN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|