C26H20N2O6 — CID 2389975
ethyl 4-[4-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate (PubChem CID 2389975) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is ethyl 4-[4-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate.
| Compound Name | ethyl 4-[4-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 2389975 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | ethyl 4-[4-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(/C=N/c3ccc4c(c3)OCO4)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H20N2O6/c1-2-32-26(31)16-7-10-18(11-8-16)28-24(29)20-6-4-3-5-19(20)21(25(28)30)14-27-17-9-12-22-23(13-17)34-15-33-22/h3-14,30H,2,15H2,1H3/b27-14+ |
| InChIKey | DARDVXYBJFIVMJ-MZJWZYIUSA-N |
| XLogP | 4.35 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|