C21H22N4O4S — CID 4868581
5-methyl-4-[(3-morpholin-4-ylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 4868581) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 5-methyl-4-[(3-morpholin-4-ylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[(3-morpholin-4-ylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 4868581 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 5-methyl-4-[(3-morpholin-4-ylsulfonylphenyl)iminomethyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H22N4O4S/c1-16-20(21(26)25(23-16)18-7-3-2-4-8-18)15-22-17-6-5-9-19(14-17)30(27,28)24-10-12-29-13-11-24/h2-9,14-15,23H,10-13H2,1H3/b22-15+ |
| InChIKey | AWUDQUVRWITMBH-PXLXIMEGSA-N |
| XLogP | 2.25 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|