C24H10F6N2O4 — CID 130470114
2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 130470114) has the molecular formula C24H10F6N2O4 and a molecular weight of 504.34 g/mol. Its IUPAC name is 2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 130470114 |
| Molecular Formula | C24H10F6N2O4 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(-c4ccccc4C(F)(F)F)c(=O)c3cc2c(=O)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H10F6N2O4/c25-23(26,27)15-5-1-3-7-17(15)31-19(33)11-9-13-14(10-12(11)20(31)34)22(36)32(21(13)35)18-8-4-2-6-16(18)24(28,29)30/h1-10H |
| InChIKey | ULEWDZLWEYUSOO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |