C26H8F12N2O4 — CID 87857766
4,8-bis(trifluoromethyl)-2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 87857766) has the molecular formula C26H8F12N2O4 and a molecular weight of 640.34 g/mol. Its IUPAC name is 4,8-bis(trifluoromethyl)-2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(trifluoromethyl)-2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 87857766 |
| Molecular Formula | C26H8F12N2O4 |
| Molecular Weight | 640.34 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | 4,8-bis(trifluoromethyl)-2,6-bis[2-(trifluoromethyl)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2c(C(F)(F)F)c3c(=O)n(-c4ccccc4C(F)(F)F)c(=O)c3c(C(F)(F)F)c2c(=O)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H8F12N2O4/c27-23(28,29)9-5-1-3-7-11(9)39-19(41)13-14(20(39)42)18(26(36,37)38)16-15(17(13)25(33,34)35)21(43)40(22(16)44)12-8-4-2-6-10(12)24(30,31)32/h1-8H |
| InChIKey | TUDKLNDVVGIRSS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |