C23H17ClN2O3 — CID 135674681
2-(3-chlorophenyl)-3-hydroxy-4-[(2-hydroxy-4-methylphenyl)iminomethyl]isoquinolin-1-one (PubChem CID 135674681) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-hydroxy-4-[(2-hydroxy-4-methylphenyl)iminomethyl]isoquinolin-1-one.
| Compound Name | 2-(3-chlorophenyl)-3-hydroxy-4-[(2-hydroxy-4-methylphenyl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135674681 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(3-chlorophenyl)-3-hydroxy-4-[(2-hydroxy-4-methylphenyl)iminomethyl]isoquinolin-1-one |
| SMILES | Cc1ccc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C23H17ClN2O3/c1-14-9-10-20(21(27)11-14)25-13-19-17-7-2-3-8-18(17)22(28)26(23(19)29)16-6-4-5-15(24)12-16/h2-13,27,29H,1H3/b25-13+ |
| InChIKey | AUEYRNSBAQQXQX-DHRITJCHSA-N |
| XLogP | 5.11 |
| TPSA | 74.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|