C30H27N3O4S — CID 3981443
N,N-diethyl-3-[3-hydroxy-4-(naphthalen-1-yliminomethyl)-1-oxoisoquinolin-2-yl]benzenesulfonamide (PubChem CID 3981443) has the molecular formula C30H27N3O4S and a molecular weight of 525.63 g/mol. Its IUPAC name is N,N-diethyl-3-[3-hydroxy-4-(naphthalen-1-yliminomethyl)-1-oxoisoquinolin-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[3-hydroxy-4-(naphthalen-1-yliminomethyl)-1-oxoisoquinolin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3981443 |
| Molecular Formula | C30H27N3O4S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N,N-diethyl-3-[3-hydroxy-4-(naphthalen-1-yliminomethyl)-1-oxoisoquinolin-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-n2c(O)c(/C=N/c3cccc4ccccc34)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C30H27N3O4S/c1-3-32(4-2)38(36,37)23-14-10-13-22(19-23)33-29(34)26-17-8-7-16-25(26)27(30(33)35)20-31-28-18-9-12-21-11-5-6-15-24(21)28/h5-20,35H,3-4H2,1-2H3/b31-20+ |
| InChIKey | RGYLZXDSNXDAKP-AJBULDERSA-N |
| XLogP | 5.63 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|