C37H33N5O6S — CID 135781191
N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide (PubChem CID 135781191) has the molecular formula C37H33N5O6S and a molecular weight of 675.77 g/mol. Its IUPAC name is N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide.
| Compound Name | N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 135781191 |
| Molecular Formula | C37H33N5O6S |
| Molecular Weight | 675.77 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-n2c(O)c(/C=N/NC(=O)c3ccc(COc4cccc5cccnc45)cc3)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C37H33N5O6S/c1-3-41(4-2)49(46,47)29-13-8-12-28(22-29)42-36(44)31-15-6-5-14-30(31)32(37(42)45)23-39-40-35(43)27-19-17-25(18-20-27)24-48-33-16-7-10-26-11-9-21-38-34(26)33/h5-23,45H,3-4,24H2,1-2H3,(H,40,43)/b39-23+ |
| InChIKey | ZZBRBBFXNIBLAP-JRZNSJKLSA-N |
| XLogP | 5.62 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|