C24H19N3O4 — CID 2368203
N-[(2,3-dihydroxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide (PubChem CID 2368203) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[(2,3-dihydroxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide.
| Compound Name | N-[(2,3-dihydroxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 2368203 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(2,3-dihydroxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
| SMILES | O=C(NN=Cc1cccc(O)c1O)c1ccc(COc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C24H19N3O4/c28-20-7-1-5-19(23(20)29)14-26-27-24(30)18-11-9-16(10-12-18)15-31-21-8-2-4-17-6-3-13-25-22(17)21/h1-14,28-29H,15H2,(H,27,30) |
| InChIKey | KDROEBLAACJVIP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|