C32H35N3O3 — CID 3994710
N-[(4-octoxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide (PubChem CID 3994710) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[(4-octoxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide.
| Compound Name | N-[(4-octoxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 3994710 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | N-[(4-octoxyphenyl)methylideneamino]-4-(quinolin-8-yloxymethyl)benzamide |
| SMILES | CCCCCCCCOc1ccc(C=NNC(=O)c2ccc(COc3cccc4cccnc34)cc2)cc1 |
| InChI | InChI=1S/C32H35N3O3/c1-2-3-4-5-6-7-22-37-29-19-15-25(16-20-29)23-34-35-32(36)28-17-13-26(14-18-28)24-38-30-12-8-10-27-11-9-21-33-31(27)30/h8-21,23H,2-7,22,24H2,1H3,(H,35,36) |
| InChIKey | BVBJWSKALKQAEB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|