C29H26N6O5S2 — CID 4308545
N,N-diethyl-3-[3-hydroxy-1-oxo-4-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]iminomethyl]isoquinolin-2-yl]benzenesulfonamide (PubChem CID 4308545) has the molecular formula C29H26N6O5S2 and a molecular weight of 602.70 g/mol. Its IUPAC name is N,N-diethyl-3-[3-hydroxy-1-oxo-4-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]iminomethyl]isoquinolin-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[3-hydroxy-1-oxo-4-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]iminomethyl]isoquinolin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4308545 |
| Molecular Formula | C29H26N6O5S2 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N,N-diethyl-3-[3-hydroxy-1-oxo-4-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]iminomethyl]isoquinolin-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-n2c(O)c(/C=N/c3ccccc3-c3n[nH]c(=S)[nH]c3=O)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C29H26N6O5S2/c1-3-34(4-2)42(39,40)19-11-9-10-18(16-19)35-27(37)21-13-6-5-12-20(21)23(28(35)38)17-30-24-15-8-7-14-22(24)25-26(36)31-29(41)33-32-25/h5-17,38H,3-4H2,1-2H3,(H2,31,33,36,41)/b30-17+ |
| InChIKey | DHYGDWFDZJTRMP-OCSSWDANSA-N |
| XLogP | 4.29 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|