C23H24FN3O2 — CID 136792757
4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-2-(2-fluorophenyl)-3-hydroxyisoquinolin-1-one (PubChem CID 136792757) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-2-(2-fluorophenyl)-3-hydroxyisoquinolin-1-one.
| Compound Name | 4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-2-(2-fluorophenyl)-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 136792757 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-2-(2-fluorophenyl)-3-hydroxyisoquinolin-1-one |
| SMILES | CCN1CCC[C@@H]1C/N=C/c1c(O)n(-c2ccccc2F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H24FN3O2/c1-2-26-13-7-8-16(26)14-25-15-19-17-9-3-4-10-18(17)22(28)27(23(19)29)21-12-6-5-11-20(21)24/h3-6,9-12,15-16,29H,2,7-8,13-14H2,1H3/b25-15+/t16-/m1/s1 |
| InChIKey | HEWMLLFLCAYXOD-FYHAJLKWSA-N |
| XLogP | 3.74 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|