C19H26N4O4 — CID 3439445
5-[3-(diethylamino)propyliminomethyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 3439445) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-[3-(diethylamino)propyliminomethyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[3-(diethylamino)propyliminomethyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3439445 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 5-[3-(diethylamino)propyliminomethyl]-6-hydroxy-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | CCN(CC)CCC/N=C/c1c(O)n(-c2ccccc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N4O4/c1-4-22(5-2)12-8-11-20-13-14-17(24)21-19(26)23(18(14)25)15-9-6-7-10-16(15)27-3/h6-7,9-10,13,25H,4-5,8,11-12H2,1-3H3,(H,21,24,26)/b20-13+ |
| InChIKey | YRAFMTPWBSTEDX-DEDYPNTBSA-N |
| XLogP | 1.39 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|