C17H16FN5O3 — CID 3377859
1-(2-fluorophenyl)-6-hydroxy-5-(3-imidazol-1-ylpropyliminomethyl)pyrimidine-2,4-dione (PubChem CID 3377859) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6-hydroxy-5-(3-imidazol-1-ylpropyliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-fluorophenyl)-6-hydroxy-5-(3-imidazol-1-ylpropyliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3377859 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(2-fluorophenyl)-6-hydroxy-5-(3-imidazol-1-ylpropyliminomethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2F)c(O)c1/C=N/CCCn1ccnc1 |
| InChI | InChI=1S/C17H16FN5O3/c18-13-4-1-2-5-14(13)23-16(25)12(15(24)21-17(23)26)10-19-6-3-8-22-9-7-20-11-22/h1-2,4-5,7,9-11,25H,3,6,8H2,(H,21,24,26)/b19-10+ |
| InChIKey | KIXHGMZOBFWLNB-VXLYETTFSA-N |
| XLogP | 1.08 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|