C15H17N3O5 — CID 2185365
6-hydroxy-5-(3-hydroxypropyliminomethyl)-1-(2-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 2185365) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 6-hydroxy-5-(3-hydroxypropyliminomethyl)-1-(2-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(3-hydroxypropyliminomethyl)-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2185365 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-hydroxy-5-(3-hydroxypropyliminomethyl)-1-(2-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | COc1ccccc1-n1c(O)c(/C=N/CCCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H17N3O5/c1-23-12-6-3-2-5-11(12)18-14(21)10(9-16-7-4-8-19)13(20)17-15(18)22/h2-3,5-6,9,19,21H,4,7-8H2,1H3,(H,17,20,22)/b16-9+ |
| InChIKey | HTLRMGHUPCTJPQ-CXUHLZMHSA-N |
| XLogP | 0.04 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|