C29H27NO2 — CID 11898113
(3aS,4S,7S,7aS)-4,7-diphenyl-2-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11898113) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3aS,4S,7S,7aS)-4,7-diphenyl-2-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7S,7aS)-4,7-diphenyl-2-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11898113 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (3aS,4S,7S,7aS)-4,7-diphenyl-2-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1cc(C)c(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H](c2ccccc2)C=C[C@@H]3c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H27NO2/c1-18-16-19(2)27(20(3)17-18)30-28(31)25-23(21-10-6-4-7-11-21)14-15-24(26(25)29(30)32)22-12-8-5-9-13-22/h4-17,23-26H,1-3H3/t23-,24-,25+,26+/m1/s1 |
| InChIKey | DFQXSXPRPJMBGK-XPGKHFPBSA-N |
| XLogP | 5.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|