C28H30N2O4S2 — CID 25043994
1-N,5-N-bis(2,4,6-trimethylphenyl)naphthalene-1,5-disulfonamide (PubChem CID 25043994) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 1-N,5-N-bis(2,4,6-trimethylphenyl)naphthalene-1,5-disulfonamide.
| Compound Name | 1-N,5-N-bis(2,4,6-trimethylphenyl)naphthalene-1,5-disulfonamide |
|---|---|
| PubChem CID | 25043994 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 1-N,5-N-bis(2,4,6-trimethylphenyl)naphthalene-1,5-disulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2cccc3c(S(=O)(=O)Nc4c(C)cc(C)cc4C)cccc23)c(C)c1 |
| InChI | InChI=1S/C28H30N2O4S2/c1-17-13-19(3)27(20(4)14-17)29-35(31,32)25-11-7-10-24-23(25)9-8-12-26(24)36(33,34)30-28-21(5)15-18(2)16-22(28)6/h7-16,29-30H,1-6H3 |
| InChIKey | PCMHPZZXJKLGCZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |