C20H19NO2S — CID 100820567
N-(2,4-dimethylphenyl)-1,2-dihydroacenaphthylene-5-sulfonamide (PubChem CID 100820567) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1,2-dihydroacenaphthylene-5-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-1,2-dihydroacenaphthylene-5-sulfonamide |
|---|---|
| PubChem CID | 100820567 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1,2-dihydroacenaphthylene-5-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c4c(cccc24)CC3)c(C)c1 |
| InChI | InChI=1S/C20H19NO2S/c1-13-6-10-18(14(2)12-13)21-24(22,23)19-11-9-16-8-7-15-4-3-5-17(19)20(15)16/h3-6,9-12,21H,7-8H2,1-2H3 |
| InChIKey | ICEVHJHGONXDTE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |