C18H14FNO2S — CID 18125849
N-(1,2-dihydroacenaphthylen-5-yl)-2-fluorobenzenesulfonamide (PubChem CID 18125849) has the molecular formula C18H14FNO2S and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 18125849 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c3c(cccc13)CC2)c1ccccc1F |
| InChI | InChI=1S/C18H14FNO2S/c19-15-6-1-2-7-17(15)23(21,22)20-16-11-10-13-9-8-12-4-3-5-14(16)18(12)13/h1-7,10-11,20H,8-9H2 |
| InChIKey | QOGRLXYLJPGRHF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |