C19H16N2O3S — CID 51284207
4-(1,2-dihydroacenaphthylen-5-ylsulfamoyl)benzamide (PubChem CID 51284207) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-(1,2-dihydroacenaphthylen-5-ylsulfamoyl)benzamide.
| Compound Name | 4-(1,2-dihydroacenaphthylen-5-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51284207 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-(1,2-dihydroacenaphthylen-5-ylsulfamoyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)Nc2ccc3c4c(cccc24)CC3)cc1 |
| InChI | InChI=1S/C19H16N2O3S/c20-19(22)14-6-9-15(10-7-14)25(23,24)21-17-11-8-13-5-4-12-2-1-3-16(17)18(12)13/h1-3,6-11,21H,4-5H2,(H2,20,22) |
| InChIKey | TYLZZMJXCCMPKC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |