C19H14FNO — CID 1301177
N-(2-fluorophenyl)-1,2-dihydroacenaphthylene-5-carboxamide (PubChem CID 1301177) has the molecular formula C19H14FNO and a molecular weight of 291.32 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,2-dihydroacenaphthylene-5-carboxamide.
| Compound Name | N-(2-fluorophenyl)-1,2-dihydroacenaphthylene-5-carboxamide |
|---|---|
| PubChem CID | 1301177 |
| Molecular Formula | C19H14FNO |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(2-fluorophenyl)-1,2-dihydroacenaphthylene-5-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H14FNO/c20-16-6-1-2-7-17(16)21-19(22)15-11-10-13-9-8-12-4-3-5-14(15)18(12)13/h1-7,10-11H,8-9H2,(H,21,22) |
| InChIKey | LPOSSVCDLBKTMY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |