C19H14INO — CID 23940641
N-(4-iodophenyl)-1,2-dihydroacenaphthylene-5-carboxamide (PubChem CID 23940641) has the molecular formula C19H14INO and a molecular weight of 399.23 g/mol. Its IUPAC name is N-(4-iodophenyl)-1,2-dihydroacenaphthylene-5-carboxamide.
| Compound Name | N-(4-iodophenyl)-1,2-dihydroacenaphthylene-5-carboxamide |
|---|---|
| PubChem CID | 23940641 |
| Molecular Formula | C19H14INO |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | N-(4-iodophenyl)-1,2-dihydroacenaphthylene-5-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H14INO/c20-14-7-9-15(10-8-14)21-19(22)17-11-6-13-5-4-12-2-1-3-16(17)18(12)13/h1-3,6-11H,4-5H2,(H,21,22) |
| InChIKey | PMTTYTNEICHFSC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|